Introduction:Basic information about CAS 2436-79-5|2,4-Dimethyl-3,5-dicarbethoxypyrrole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dimethyl-3,5-dicarbethoxypyrrole |
|---|
| CAS Number | 2436-79-5 | Molecular Weight | 239.268 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 372.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H17NO4 | Melting Point | 135-136 °C(lit.) |
|---|
| MSDS | / | Flash Point | 179.0±26.5 °C |
|---|
Names
| Name | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 372.3±37.0 °C at 760 mmHg |
|---|
| Melting Point | 135-136 °C(lit.) |
|---|
| Molecular Formula | C12H17NO4 |
|---|
| Molecular Weight | 239.268 |
|---|
| Flash Point | 179.0±26.5 °C |
|---|
| Exact Mass | 239.115753 |
|---|
| PSA | 68.39000 |
|---|
| LogP | 3.85 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.516 |
|---|
| InChIKey | XSBSXJAYEPDGSF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)OCC)c1C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 3,5-dimethylpyrrole-2,4-dicarboxylic acid diethyl ester |
| Diethyl 3,5-dimethylpyrrole-2,4-dicarboxylate |
| Diethyl 2,4-Dimethyl-Pyrrol-3,5-Dicarboxylate |
| 2,4-Dimethyl-3,5-dicarbethoxypyrrole |
| 2,4-Dimethyl-3,5-diethoxycarbonyl-pyrrole |
| 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid diethyl ester |
| 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester |
| Diethyl 2 ,4-dimethylpyrrole-3,5-dicarboxylate |
| Knorr's pyrrole |
| Diethyl 3,5-DiMethyl-2,4-pyrroledicarboxylate |
| Diethyl 2,4-Dimethylpyrrole-3,5-Dicarbonate |
| 3,5-Dimethyl-2,4-pyrroledicarboxylic Acid Diethyl Ester |
| Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester |
| diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| RARECHEM AL BI 0939 |
| MFCD00005218 |
| 1H-Pyrrole, 2,4-dimethyl-3,5-diethoxycarbonyl- |
| EINECS 219-431-2 |
| 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate diethyl ester |