Introduction：Basic information about CAS 565-33-3|metahexamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | metahexamide |
|---|
| CAS Number | 565-33-3 | Molecular Weight | 311.40000 |
|---|
| Density | 1.3g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H21N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(3-amino-4-methylphenyl)sulfonyl-3-cyclohexylurea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Molecular Formula | C14H21N3O3S |
|---|
| Molecular Weight | 311.40000 |
|---|
| Exact Mass | 311.13000 |
|---|
| PSA | 113.16000 |
|---|
| LogP | 4.15510 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XXYTXQGCRQLRHA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1N |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-<3-Amino-4-methyl-phenylsulfonyl>-N-cyclohexylharnstoff,Metahexamid |
| Methexamide |
| Metahexamid |
| Metahexamide |
| Methahexamide |
| Glyhexylamine isodiane |
| Euglycin |
| Glyhexylamide |
