Introduction：Basic information about CAS 6238-97-7|ethyl 2-[3-(1H-benzimidazol-2-yl)-2-oxochromen-7-yl]oxyacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-[3-(1H-benzimidazol-2-yl)-2-oxochromen-7-yl]oxyacetate |
|---|
| CAS Number | 6238-97-7 | Molecular Weight | 364.35100 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 618.7ºC at 760 mmHg |
|---|
| Molecular Formula | C20H16N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 328ºC |
|---|
Names
| Name | ethyl 2-[3-(1H-benzimidazol-2-yl)-2-oxochromen-7-yl]oxyacetate |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 618.7ºC at 760 mmHg |
|---|
| Molecular Formula | C20H16N2O5 |
|---|
| Molecular Weight | 364.35100 |
|---|
| Flash Point | 328ºC |
|---|
| Exact Mass | 364.10600 |
|---|
| PSA | 94.42000 |
|---|
| LogP | 3.27820 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | MWLQLOUBNQLWKK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)COc1ccc2cc(-c3nc4ccccc4[nH]3)c(=O)oc2c1 |
|---|
