Introduction：Basic information about CAS 101860-83-7|1-(4-bromo-3-nitrophenyl)propan-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-bromo-3-nitrophenyl)propan-1-one |
|---|
| CAS Number | 101860-83-7 | Molecular Weight | 258.06900 |
|---|
| Density | 1.559g/cm3 | Boiling Point | 291.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H8BrNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.9ºC |
|---|
Names
| Name | 1-(4-bromo-3-nitrophenyl)propan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.559g/cm3 |
|---|
| Boiling Point | 291.2ºC at 760mmHg |
|---|
| Molecular Formula | C9H8BrNO3 |
|---|
| Molecular Weight | 258.06900 |
|---|
| Flash Point | 129.9ºC |
|---|
| Exact Mass | 256.96900 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 3.47320 |
|---|
| Vapour Pressure | 0.00197mmHg at 25°C |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | TZELZSUMAATQRO-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
|---|
Synonyms
| 1-(4-Bromo-3-nitrophenyl)-1-propanone |
| 4'-bromo-3'-nitropropiophenone |
| 3'-Nitro-4'-bromopropiophenone |
| 4-Brom-3-nitro-propiophenon |
| 4-Bromo-3-nitro-propiophenon |
