Introduction：Basic information about CAS 17025-47-7|Phenyl tribromomethyl sulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenyl tribromomethyl sulfone |
|---|
| CAS Number | 17025-47-7 | Molecular Weight | 392.890 |
|---|
| Density | 2.3±0.1 g/cm3 | Boiling Point | 373.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5Br3O2S | Melting Point | 145-147 °C(lit.) |
|---|
| MSDS | / | Flash Point | 179.9±27.9 °C |
|---|
Names
| Name | Phenyl Tribromomethyl Sulfone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.3±0.1 g/cm3 |
|---|
| Boiling Point | 373.8±42.0 °C at 760 mmHg |
|---|
| Melting Point | 145-147 °C(lit.) |
|---|
| Molecular Formula | C7H5Br3O2S |
|---|
| Molecular Weight | 392.890 |
|---|
| Flash Point | 179.9±27.9 °C |
|---|
| Exact Mass | 389.756012 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.51 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | DWWMSEANWMWMCB-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1ccccc1)C(Br)(Br)Br |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Tribromomethyl phenyl sulfone |
| tribromomethylsulfonylbenzene |
| Benzene, [(tribromomethyl)sulfonyl]- |
| ((Tribromomethyl)sulfonyl)benzene |
| ((Tribromomethyl)sulphonyl)benzene |
| MFCD00060068 |
| [(Tribromomethyl)sulfonyl]benzene |
| EINECS 241-096-6 |
| Benzene, ((tribromomethyl)sulfonyl)- |
| Phenyl tribromomethyl sulfone |
