Introduction：Basic information about CAS 32588-54-8|2-(1,1-Dimethyl-propyl)-anthraquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(1,1-Dimethyl-propyl)-anthraquinone |
|---|
| CAS Number | 32588-54-8 | Molecular Weight | 278.345 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 432.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H18O2 | Melting Point | 60-65ºC |
|---|
| MSDS | / | Flash Point | 161.6±22.9 °C |
|---|
Names
| Name | 2-(1,1-Dimethylpropyl)anthraquinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 432.9±35.0 °C at 760 mmHg |
|---|
| Melting Point | 60-65ºC |
|---|
| Molecular Formula | C19H18O2 |
|---|
| Molecular Weight | 278.345 |
|---|
| Flash Point | 161.6±22.9 °C |
|---|
| Exact Mass | 278.130676 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 5.60 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | WUKWGUZTPMOXOW-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
|---|
Safety Information
Customs
| HS Code | 2914690090 |
|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2-tert-amyl-9,10-anthraquinone |
| 9,10-Anthracenedione, 2-(1,1-dimethylpropyl)- |
| 2-(2-Methyl-2-butanyl)-9,10-anthraquinone |
| 2-(2-Methylbutan-2-yl)anthracen-9,10-dion |
| 2-(2-Methylbutan-2-yl)-9,10-anthraquinone |
| MFCD00082163 |
| 2-t-Isopentylanthrachinon |
| 2-tert-amylanthraquinone |
| 2-t-amylanthraquinone |
| EINECS 251-116-5 |
| 2-(2-methylbutan-2-yl)anthracene-9,10-dione |
| 2-(1,1-Dimethyl-propyl)-anthraquinone |
| 2-TERT-PENTYLANTHRAQUINONE |
