Introduction：Basic information about CAS 50413-24-6|2-Bromo-1-[4-(methylsulfonyl)phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-1-[4-(methylsulfonyl)phenyl]ethanone |
|---|
| CAS Number | 50413-24-6 | Molecular Weight | 277.135 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 428.4±41.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9BrO3S | Melting Point | 126 °C |
|---|
| MSDS | / | Flash Point | 212.9±27.6 °C |
|---|
Names
| Name | 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 428.4±41.0 °C at 760 mmHg |
|---|
| Melting Point | 126 °C |
|---|
| Molecular Formula | C9H9BrO3S |
|---|
| Molecular Weight | 277.135 |
|---|
| Flash Point | 212.9±27.6 °C |
|---|
| Exact Mass | 275.945557 |
|---|
| PSA | 59.59000 |
|---|
| LogP | 0.92 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | JOCMYOUZIDSYFO-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(C(=O)CBr)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
Synonyms
| 2-Bromo-1-[4-(methylsulfonyl)phenyl]ethan-1-one |
| 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone |
| 2-Bromo-1-[4-(methylsulfonyl)phenyl]ethanone |
| Ethanone, 2-bromo-1-[4-(methylsulfonyl)phenyl]- |
| WS1&R DV1E |
| 2-Bromo-1-(4-(methylsulfonyl)phenyl)ethanone |
| 2-bromo-1-(4-methylsulfonylphenyl)ethanone |
| 2-Bromo-4'-(methylsulfonyl)acetophenone |
| MFCD00673134 |
