Introduction：Basic information about CAS 93982-96-8|1,3-Diphenylguanidine hydrobromide (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Diphenylguanidine hydrobromide (1:1) |
|---|
| CAS Number | 93982-96-8 | Molecular Weight | 292.174 |
|---|
| Density | / | Boiling Point | 364.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14BrN3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.1ºC |
|---|
Names
| Name | N,N-Diphenylguanidine Monohydrobromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 364.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14BrN3 |
|---|
| Molecular Weight | 292.174 |
|---|
| Flash Point | 174.1ºC |
|---|
| Exact Mass | 291.037109 |
|---|
| PSA | 47.91000 |
|---|
| LogP | 4.34920 |
|---|
| InChIKey | DSESGJJGBBAHNW-UHFFFAOYSA-N |
|---|
| SMILES | Br.NC(=Nc1ccccc1)Nc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 301-283-6 |
| 1,1-diphenylguanidine,hydrobromide |
| 1,1-Diphenylguanidine hydrobromide (1:1) |
| 1,3-Diphenylguanidine hydrobromide (1:1) |
| Guanidine, N,N-diphenyl-, hydrobromide (1:1) |
| MFCD04038163 |
| Guanidine, N,N'-diphenyl-, hydrobromide (1:1) |
