Introduction：Basic information about CAS 103-43-5|dibenzyl succinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dibenzyl succinate |
|---|
| CAS Number | 103-43-5 | Molecular Weight | 298.33300 |
|---|
| Density | 1.256 | Boiling Point | 245°C/15mm |
|---|
| Molecular Formula | C18H18O4 | Melting Point | 42-43°C |
|---|
| MSDS | / | Flash Point | 245°C/15mm |
|---|
Names
| Name | dibenzyl butanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.256 |
|---|
| Boiling Point | 245°C/15mm |
|---|
| Melting Point | 42-43°C |
|---|
| Molecular Formula | C18H18O4 |
|---|
| Molecular Weight | 298.33300 |
|---|
| Flash Point | 245°C/15mm |
|---|
| Exact Mass | 298.12100 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.25340 |
|---|
| Vapour Pressure | 3.82E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.5960 |
|---|
| InChIKey | ODBOBZHTGBGYCK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCC(=O)OCc1ccccc1)OCc1ccccc1 |
|---|
Safety Information
| Safety Phrases | S24/25-S22 |
|---|
| RTECS | TU5011500 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Bernsteinsaeure-dibenzylester |
| bis(phenylmethyl) ester |
| Benzyl succinate |
| Dibenzyl-succinat |
| DIBENZYL SUCCINATE |
| Butanedioic acid,bis(phenylmethyl) ester |
| MFCD00022034 |
| Spasmine |
| diphenylmethyl butane-1,4-dioate |
| Succinic acid,dibenzyl ester |
| Berbsteinsaeuredibenzylester |
| EINECS 203-110-9 |
