Introduction：Basic information about CAS 412048-44-3|(4-bromoindol-1-yl)-tri(propan-2-yl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-bromoindol-1-yl)-tri(propan-2-yl)silane |
|---|
| CAS Number | 412048-44-3 | Molecular Weight | 352.38500 |
|---|
| Density | 1.14g/cm3 | Boiling Point | 339.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H26BrNSi | Melting Point | 62ºC |
|---|
| MSDS | / | Flash Point | 159.3ºC |
|---|
Names
| Name | (4-bromoindol-1-yl)-tri(propan-2-yl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.14g/cm3 |
|---|
| Boiling Point | 339.8ºC at 760 mmHg |
|---|
| Melting Point | 62ºC |
|---|
| Molecular Formula | C17H26BrNSi |
|---|
| Molecular Weight | 352.38500 |
|---|
| Flash Point | 159.3ºC |
|---|
| Exact Mass | 351.10200 |
|---|
| PSA | 4.93000 |
|---|
| LogP | 6.42740 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | ZXHMUQVMGJYGAV-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(Br)cccc21 |
|---|
Synonyms
| 4-bromo-1-triisopropylsilanyl-1H-indole |
| 4-bromo-N-triisopropylsilylindole |
| 4-bromo-1-(triisopropylsilyl)indole |
| 4-bromo-1-TIPS indole |
| 4-bromo-triisopropylsilanyl-1H-indole |
| 4-Bromo-1-(tri-isopropylsilyl)-1H-indole |
