Introduction：Basic information about CAS 507472-19-7|fmoc-(s)-3-amino-3-(2-trifluoromethyl-phenyl)-propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-(s)-3-amino-3-(2-trifluoromethyl-phenyl)-propionic acid |
|---|
| CAS Number | 507472-19-7 | Molecular Weight | 455.42600 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 614ºC at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 325.1ºC |
|---|
Names
| Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 614ºC at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 |
|---|
| Molecular Weight | 455.42600 |
|---|
| Flash Point | 325.1ºC |
|---|
| Exact Mass | 455.13400 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 6.15080 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | WUSGYGWDKAFPBR-QFIPXVFZSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1C(F)(F)F |
|---|
Synonyms
| Fmoc-(S)-3-Amino-3-(2-trifluoromethyl-phenyl)-propionic acid |
| FMOC-D-PHG(2-CF3)-(C*CH2)OH |
| (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid |
