Introduction:Basic information about CAS 6970-19-0|Benzoic acid,3,4,5-triethoxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,3,4,5-triethoxy- |
|---|
| CAS Number | 6970-19-0 | Molecular Weight | 254.27900 |
|---|
| Density | 1.137 g/cm3 | Boiling Point | 372.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O5 | Melting Point | 109-112 °C |
|---|
| MSDS | / | Flash Point | 135.7ºC |
|---|
Names
| Name | 3,4,5-triethoxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.137 g/cm3 |
|---|
| Boiling Point | 372.3ºC at 760 mmHg |
|---|
| Melting Point | 109-112 °C |
|---|
| Molecular Formula | C13H18O5 |
|---|
| Molecular Weight | 254.27900 |
|---|
| Flash Point | 135.7ºC |
|---|
| Exact Mass | 254.11500 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 2.58090 |
|---|
| InChIKey | YCENSLDYFDZUMO-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc(C(=O)O)cc(OCC)c1OCC |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S24/25-S37/39-S26 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| AC1L31BI |
| 3,4,5-Triaethoxy-benzoesaeure |
| AC1Q5TSP |
| MFCD00002505 |
| Benzoic acid,3,4,5-triethoxy |
| EINECS 230-192-3 |
| 3,4,5-(OCH2CH3)3-benzoic acid |
| 3,4,5-tri(ethoxy)benzoic acid |
| Triaethylaethergallussaeure |