Introduction:Basic information about CAS 89001-53-6|p-Nitro-α-tolunitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Nitro-α-tolunitrile |
|---|
| CAS Number | 89001-53-6 | Molecular Weight | 162.145 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 329.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O2 | Melting Point | 100-103ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 153.1±24.6 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Methyl-4-nitrobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 329.6±30.0 °C at 760 mmHg |
|---|
| Melting Point | 100-103ºC(lit.) |
|---|
| Molecular Formula | C8H6N2O2 |
|---|
| Molecular Weight | 162.145 |
|---|
| Flash Point | 153.1±24.6 °C |
|---|
| Exact Mass | 162.042923 |
|---|
| PSA | 69.61000 |
|---|
| LogP | 1.65 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | RNTFKDBRMXYEPR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])ccc1C#N |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Benzonitrile, 2-methyl-4-nitro- |
| 2-cyano-5-nitrotoluene |
| 2-methyl-4-nitro-benzonitrile |
| p-Nitro-α-tolunitrile |
| 4-Cyano-3-methylnitrobenzene |
| 4-Nitro-o-tolunitrile |
| 2-Methyl-4-nitrobenzonitrile |
| 2-methyl-4-nitrobenzenecarbonitrile |
| MFCD03095378 |