Introduction：Basic information about CAS 66737-88-0|4-Hydroxy-3-(2-methyl-2-propanyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Hydroxy-3-(2-methyl-2-propanyl)benzoic acid |
|---|
| CAS Number | 66737-88-0 | Molecular Weight | 194.227 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 331.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14O3 | Melting Point | 157-159ºC |
|---|
| MSDS | USA | Flash Point | 168.4±22.4 °C |
|---|
Names
| Name | 3-tert-butyl-4-hydroxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 331.4±35.0 °C at 760 mmHg |
|---|
| Melting Point | 157-159ºC |
|---|
| Molecular Formula | C11H14O3 |
|---|
| Molecular Weight | 194.227 |
|---|
| Flash Point | 168.4±22.4 °C |
|---|
| Exact Mass | 194.094299 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 3.11 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | PVFDJRIEGYDIEK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(C(=O)O)ccc1O |
|---|
Safety Information
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Hydroxy-3-(2-methyl-2-propanyl)benzoic acid |
| 3-(tert-Butyl)-4-hydroxybenzoic acid |
| Benzoic acid, 3-(1,1-dimethylethyl)-4-hydroxy- |
| 4-hydroxy-3tert-butyl benzoic acid |
| 3-(1,1-Dimethylethyl)-4-hydroxy-benzaldehyde |
| 4-hydroxy-3-tert-butylbenzaldehyde |
| 5-Di-tert-butyl-4-hydroxybenzaldehyde |
| 3-(tert-butyl)-4-hydroxybenzaldehyde |
