Introduction：Basic information about CAS 10292-65-6|(o-Nitrophenyl)cyclopropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (o-Nitrophenyl)cyclopropane |
|---|
| CAS Number | 10292-65-6 | Molecular Weight | 163.173 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 250.4±19.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 109.3±14.3 °C |
|---|
Names
| Name | 1-Cyclopropyl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 250.4±19.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9NO2 |
|---|
| Molecular Weight | 163.173 |
|---|
| Flash Point | 109.3±14.3 °C |
|---|
| Exact Mass | 163.063324 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.00 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | VANZICVFDGMCIU-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1C1CC1 |
|---|
Synonyms
| 2-Nitrophenylcyclopropane |
| Benzene, 1-cyclopropyl-2-nitro- |
| 1-Cyclopropyl-2-nitro-benzol |
| (o-Nitrophenyl)cyclopropane |
| Benzene,1-cyclopropyl-2-nitro |
| 1-Cyclopropyl-2-nitrobenzene |
| 2-cyclopropyl-1-nitrobenzene |
| 1-cyclopropyl-2-nitro-benzene |
