Introduction：Basic information about CAS 52172-19-7|7-Hydroxy Prochlorperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Hydroxy Prochlorperazine |
|---|
| CAS Number | 52172-19-7 | Molecular Weight | 389.94200 |
|---|
| Density | 1.276g/cm3 | Boiling Point | 569.962ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24ClN3OS | Melting Point | 196-197ºC |
|---|
| MSDS | / | Flash Point | 298.503ºC |
|---|
Names
| Name | 8-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazin-3-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.276g/cm3 |
|---|
| Boiling Point | 569.962ºC at 760 mmHg |
|---|
| Melting Point | 196-197ºC |
|---|
| Molecular Formula | C20H24ClN3OS |
|---|
| Molecular Weight | 389.94200 |
|---|
| Flash Point | 298.503ºC |
|---|
| Exact Mass | 389.13300 |
|---|
| PSA | 55.25000 |
|---|
| LogP | 4.22660 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | BRUHMTGXYBUCRP-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(CCCN2c3ccc(O)cc3Sc3ccc(Cl)cc32)CC1 |
|---|
Safety Information
Customs
| HS Code | 2934300000 |
|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Prochlorperazine 7-Hydroxide |
| 7-Hydroxyprochlorperazin |
| 7-Hydroxy Prochlorperazine |
| 8-chloro-10-[3-(4-methyl-piperazin-1-yl)-propyl]-10H-phenothiazin-3-ol |
| 8-Chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazin-3-ol |
