Introduction:Basic information about CAS 27619-97-2|3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
|---|
| CAS Number | 27619-97-2 | Molecular Weight | 428.168 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 221.2ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5F13O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 87.6ºC |
|---|
Names
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 221.2ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5F13O3S |
|---|
| Molecular Weight | 428.168 |
|---|
| Flash Point | 87.6ºC |
|---|
| Exact Mass | 427.975189 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 3.47 |
|---|
| Vapour Pressure | 0.109mmHg at 25°C |
|---|
| Index of Refraction | 1.330 |
|---|
| InChIKey | VIONGDJUYAYOPU-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C,Xi |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3265 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-Octanesulfonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonic acid |
| 1H,1H,2H,2H-perfluorooctyl-1-sulfonic acid |
| EINECS 248-580-6 |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulfonic acid |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanesulfonic acid |
| 6:2 fluorotelomer sulfonic acid |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
| 1H,1H,2H,2H-perfluorooctane sulfonate |