Introduction：Basic information about CAS 57664-96-7|Noroxycodone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Noroxycodone |
|---|
| CAS Number | 57664-96-7 | Molecular Weight | 302.34500 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 528.4ºC at 760mmHg |
|---|
| Molecular Formula | C17H20NO4 | Melting Point | 166-168ºC |
|---|
| MSDS | / | Flash Point | 273.4ºC |
|---|
Names
| Name | (4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 528.4ºC at 760mmHg |
|---|
| Melting Point | 166-168ºC |
|---|
| Molecular Formula | C17H20NO4 |
|---|
| Molecular Weight | 302.34500 |
|---|
| Flash Point | 273.4ºC |
|---|
| Exact Mass | 302.13900 |
|---|
| PSA | 67.79000 |
|---|
| LogP | 1.74310 |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | RIKMCJUNPCRFMW-ISWURRPUSA-N |
|---|
| SMILES | COc1ccc2c3c1OC1C(=O)CCC4(O)C(C2)NCCC314 |
|---|
Synonyms
| (5|A)-4,5-Epoxy-14-hydroxy-3-methoxymorphinan-6-one |
| N-noroxycodone |
| EINECS 260-887-7 |
| 7,8-Dihydro-14-hydroxynorcodeinone |
| Dihydro-14-hydroxy-norcodeinon |
| Morphinan-6-one,4,5-epoxy-14-hydroxy-3-methoxy-,(5alpha) |
| noroxycodone |
| (5alpha)-4,5-Epoxy-14-hydroxy-3-methoxymorphinan-6-one |
| Morphinan-6-one,4,5-epoxy-14-hydroxy-3-methoxy-,(5alpha)-(9CI) |
