Introduction：Basic information about CAS 23108-72-7|Methyl(triphenylphosphine)gold(I), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl(triphenylphosphine)gold(I) |
|---|
| CAS Number | 23108-72-7 | Molecular Weight | 474.28700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H18AuP | Melting Point | 150ºC (dec.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | carbanide,gold(1+),triphenylphosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 150ºC (dec.) |
|---|
| Molecular Formula | C19H18AuP |
|---|
| Molecular Weight | 474.28700 |
|---|
| Exact Mass | 474.08100 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 4.02610 |
|---|
| InChIKey | AIJHVWFIEVTCNT-UHFFFAOYSA-N |
|---|
| SMILES | [Au+].[CH3-].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P280-P301 + P312 + P330-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 22-36/37/38 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
