Introduction：Basic information about CAS 27255-72-7|7-Phenyl-acetamido-deacetoxy-cephalosporanic-acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Phenyl-acetamido-deacetoxy-cephalosporanic-acid |
|---|
| CAS Number | 27255-72-7 | Molecular Weight | 332.37400 |
|---|
| Density | 1.46g/cm3 | Boiling Point | 707.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 381.8ºC |
|---|
Names
| Name | (6R,7R)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46g/cm3 |
|---|
| Boiling Point | 707.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16N2O4S |
|---|
| Molecular Weight | 332.37400 |
|---|
| Flash Point | 381.8ºC |
|---|
| Exact Mass | 332.08300 |
|---|
| PSA | 112.01000 |
|---|
| LogP | 1.31640 |
|---|
| Vapour Pressure | 5.08E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | CIPQGGYPCPIDBB-IUODEOHRSA-N |
|---|
| SMILES | CC1=C(C(=O)O)N2C(=O)C(NC(=O)Cc3ccccc3)C2SC1 |
|---|
Synonyms
| desacetoxycephalosporin G |
| (6r,7r)-3-methyl-8-oxo-7-[(phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| BB_NC-1401 |
| (6R)-3-methyl-8-oxo-7t-(2-phenyl-acetylamino)-(6rH)-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7-phenylacetamidodesacetoxycephalosporanic acid |
| (6R,7R)-3-methyl-7-phenylacetamido-ceph-3-em-4-carboxylic acid |
| (6R-trans)-3-Methyl-8-oxo-7-(phenylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| cephalosporin G |
