Introduction：Basic information about CAS 23056-40-8|2-Chloro-3-nitro-5-picoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-nitro-5-picoline |
|---|
| CAS Number | 23056-40-8 | Molecular Weight | 172.569 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 290.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5ClN2O2 | Melting Point | 46-50 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 129.7±25.9 °C |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 2-Chloro-5-methyl-3-nitropyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 290.8±35.0 °C at 760 mmHg |
|---|
| Melting Point | 46-50 °C |
|---|
| Molecular Formula | C6H5ClN2O2 |
|---|
| Molecular Weight | 172.569 |
|---|
| Flash Point | 129.7±25.9 °C |
|---|
| Exact Mass | 172.003952 |
|---|
| PSA | 58.71000 |
|---|
| LogP | 1.49 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | LUAJUWOJEFFNFE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cnc(Cl)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R21/22;R36/37/38 |
|---|
| Safety Phrases | S36/37/39-S26 |
|---|
| RIDADR | 2811 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2933399090 |
|---|
Preparation
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Chloro-5-methyl-3-nitropyridine |
| MFCD02070020 |
| 6-Chloro-5-nitro-3-picoline |
| 2-Chlor-3-nitro-5-methyl-pyridin |
| 2-Chloro-5-Methyl-3-Nitro Pyridine |
| 2-Chloro-3-nitro-5-picoline |
| 2-chloro-3-nitro-5-methylpyridine |
| Pyridine, 2-chloro-5-methyl-3-nitro- |
| 2-Chlor-5-methyl-3-nitro-pyridin |
| 2-Chloro-5-methyl-3-nitro-pyridine |
