Introduction:Basic information about CAS 2389-60-8|Z-Lys(Boc)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Lys(Boc)-OH |
|---|
| CAS Number | 2389-60-8 | Molecular Weight | 246.303 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 412.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H22N2O4 | Melting Point | 50-52ºC (dec.) |
|---|
| MSDS | / | Flash Point | 203.5±27.3 °C |
|---|
Names
| Name | (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 412.9±40.0 °C at 760 mmHg |
|---|
| Melting Point | 50-52ºC (dec.) |
|---|
| Molecular Formula | C11H22N2O4 |
|---|
| Molecular Weight | 246.303 |
|---|
| Flash Point | 203.5±27.3 °C |
|---|
| Exact Mass | 246.157959 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 0.74 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | DYSBKEOCHROEGX-HNNXBMFYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Z-Lys(Boc)-OH |
| MFCD00062271 |
| N-[(Benzyloxy)carbonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}lysine |
| N2-BENZYLOXYCARBONYL-N6-BOC-L-LYSINE |
| (S)-2-Amino-6-((tert-butoxycarbonyl)amino)hexanoic acid |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-lysine |
| (S)-2-(((Benzyloxy)carbonyl)amino)-6-((tert-butoxycarbonyl)amino)hexanoic acid |
| L-Lysine, N-[(1,1-dimethylethoxy)carbonyl]- |
| N2-benzyloxycarbonyl-N6-tert-butoxycarbonyl-L-lysine |
| L-Lysine, N6-((1,1-dimethylethoxy)carbonyl)- |
| Lysine derivative 1 |
| AmbotzZAA1184 |
| Lysine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(phenylmethoxy)carbonyl]- |
| N-(Tert-Butoxycarbonyl)-L-Lysine |
| N-Cbz-N'-Boc-L-lysine |
| N2-Benzyloxycarbonyl-N6-tert-butyloxycarbonyl-L-lysine |
| Nε-Boc-Nα-Cbz-L-lysine |
| EINECS 219-223-1 |
| Nε-(tert-Butoxycarbonyl)-Nα-carbobenzoxy-L-lysine |
| Nepsilon-Boc-Nalpha-Cbz-L-Lysine |