Introduction：Basic information about CAS 23047-95-2|Benzenamine,2-(5-phenyl-1,3,4-oxadiazol-2-yl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenamine,2-(5-phenyl-1,3,4-oxadiazol-2-yl)- |
|---|
| CAS Number | 23047-95-2 | Molecular Weight | 237.25700 |
|---|
| Density | 1.238g/cm3 | Boiling Point | 438.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H11N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.9ºC |
|---|
Names
| Name | 2-(5-phenyl-1,3,4-oxadiazol-2-yl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.238g/cm3 |
|---|
| Boiling Point | 438.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H11N3O |
|---|
| Molecular Weight | 237.25700 |
|---|
| Flash Point | 218.9ºC |
|---|
| Exact Mass | 237.09000 |
|---|
| PSA | 64.94000 |
|---|
| LogP | 3.56700 |
|---|
| Vapour Pressure | 7E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | BRUOFARTOPHRMH-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccccc1-c1nnc(-c2ccccc2)o1 |
|---|
Synonyms
| 2-(o-aminophenyl)-5-phenyl-1,3,4-oxadiazole |
| 2-(5-phenyl-[1,3,4]oxadiazol-2-yl)-aniline |
| 2-(2-aminophenyl)-5-phenyl-1,3,4-oxadiazol |
| 2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenylamine |
| 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenamine |
