Introduction:Basic information about CAS 6292-61-1|1-Naphthalenesulfonamide,4-chloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthalenesulfonamide,4-chloro- |
|---|
| CAS Number | 6292-61-1 | Molecular Weight | 241.69400 |
|---|
| Density | 1.469g/cm3 | Boiling Point | 445.2ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223ºC |
|---|
Names
| Name | 4-chloro-naphthalene-1-sulfonic acid amide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.469g/cm3 |
|---|
| Boiling Point | 445.2ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClNO2S |
|---|
| Molecular Weight | 241.69400 |
|---|
| Flash Point | 223ºC |
|---|
| Exact Mass | 240.99600 |
|---|
| PSA | 68.54000 |
|---|
| LogP | 3.92170 |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | YQXWHPSJAYLYED-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1ccc(Cl)c2ccccc12 |
|---|
Synonyms
| 1,8-Naphthalenedicarboxylic acid,4-chloro |
| Naphthalic acid,4-chloro |
| 4-chloro-naphthalene-1,8-dicarboxylic acid |
| 4-Chlor-naphthalin-1-sulfonsaeure-amid |
| 4-Chloronaphthalic acid |
| 4-Chlornapthylsaeure |
| 4-Chlor-naphthalin-1,8-dicarbonsaeure |
| 4-Chlornaphthalsaeure |
| 4-Chloro-1,8-naphthalenedicarboxylic acid |