Introduction：Basic information about CAS 890-98-2|Benzylmandelate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzylmandelate |
|---|
| CAS Number | 890-98-2 | Molecular Weight | 242.270 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 386.8±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O3 | Melting Point | 93-95ºC |
|---|
| MSDS | / | Flash Point | 163.0±16.5 °C |
|---|
Names
| Name | Benzyl DL-Mandelate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 386.8±27.0 °C at 760 mmHg |
|---|
| Melting Point | 93-95ºC |
|---|
| Molecular Formula | C15H14O3 |
|---|
| Molecular Weight | 242.270 |
|---|
| Flash Point | 163.0±16.5 °C |
|---|
| Exact Mass | 242.094299 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.82 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | JFKWZVQEMSKSBU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCc1ccccc1)C(O)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22 |
|---|
| Safety Phrases | 22-24/25 |
|---|
| HS Code | 2918199090 |
|---|
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Benzeneacetic acid, α-hydroxy-, phenylmethyl ester (9CI) |
| Mandelic acid, benzyl ester |
| Benzeneacetic acid, α-hydroxy-, phenylmethyl ester |
| Phenylglycolic acid benzyl ester |
| MFCD00021856 |
| benzyl 2-hydroxy-2-phenylacetate |
| Mandelic acid, benzyl ester (8CI) |
| EINECS 212-965-7 |
| Benzyl hydroxy(phenyl)acetate |
| UNII:2QN49PWH71 |
