Introduction：Basic information about CAS 881-87-8|Acetamide,N-(2-chloro-4-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N-(2-chloro-4-nitrophenyl)- |
|---|
| CAS Number | 881-87-8 | Molecular Weight | 214.60600 |
|---|
| Density | 1.466g/cm3 | Boiling Point | 408.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.8ºC |
|---|
Names
| Name | N-(2-chloro-4-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.466g/cm3 |
|---|
| Boiling Point | 408.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7ClN2O3 |
|---|
| Molecular Weight | 214.60600 |
|---|
| Flash Point | 200.8ºC |
|---|
| Exact Mass | 214.01500 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 2.80280 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | OAFVRHMRZVHVDQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
|---|
Synonyms
| acetic acid-(2-chloro-4-nitro-anilide) |
| Essigsaeure-(2-chlor-4-nitro-anilid) |
| Acetanilide,2'-chloro-4'-nitro |
| 2-chloro-4-nitroacetanilide |
| N-(2-chloro-4-nitrophenyl)-acetamide |
| 2-Chlor-4-nitro-acetanilid |
| Acetamide,N-(2-chloro-4-nitrophenyl) |
