Introduction：Basic information about CAS 32203-24-0|Benzoic acid,2-amino-5-nitro-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,2-amino-5-nitro-, ethyl ester |
|---|
| CAS Number | 32203-24-0 | Molecular Weight | 210.18700 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 385ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.7ºC |
|---|
Names
| Name | 2-Amino-5-methyl-thiophene-3-carboxylic acid ethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 385ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O4 |
|---|
| Molecular Weight | 210.18700 |
|---|
| Flash Point | 186.7ºC |
|---|
| Exact Mass | 210.06400 |
|---|
| PSA | 98.14000 |
|---|
| LogP | 2.45810 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | AMLDNINFPSEDHZ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])ccc1N |
|---|
Synonyms
| Ethyl 2-amino-5-methyl-3-thiophenecarboxylate |
| 2-Carboethoxy-4-nitroaniline |
| 2-Amino-5-methyl-3-ethoxycarbonyl-thiophene |
| 2-amino-5-methyl-3-thiophenecarboxylic acid ethyl ester |
| ethyl 2-amino-5-nitrobenzoate |
| 2-Amino-5-nitro-benzoesaeure-aethylester |
| 5-nitroanthranilic acid ethyl ester |
| 2-amino-5-nitro-benzoic acid ethyl ester |
| 2-Amino-5-nitro-benzoesaeure-ethylester |
