Introduction:Basic information about CAS 28328-53-2|3-nitro-4-phenoxy-5-sulphamoylbenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-nitro-4-phenoxy-5-sulphamoylbenzoic acid |
|---|
| CAS Number | 28328-53-2 | Molecular Weight | 338.293 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 547.6±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10N2O7S | Melting Point | 251-253°C (dec.) |
|---|
| MSDS | / | Flash Point | 285.0±32.9 °C |
|---|
Names
| Name | bumetanide related compound b (25 mg) (3-nitro-4-phenoxy-5-sulfamoylbenzoic acid) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 547.6±60.0 °C at 760 mmHg |
|---|
| Melting Point | 251-253°C (dec.) |
|---|
| Molecular Formula | C13H10N2O7S |
|---|
| Molecular Weight | 338.293 |
|---|
| Flash Point | 285.0±32.9 °C |
|---|
| Exact Mass | 338.020874 |
|---|
| PSA | 160.89000 |
|---|
| LogP | 1.81 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | NXJUSSNAIUIVKY-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1Oc1ccccc1 |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 3-Nitro-4-phenoxy-5-sulphamoylbenzoic acid |
| 3-Nitro-4-phenoxy-5-sulfamyl-benzoesaeure |
| 3-Nitro-4-oxy-phenylarsinigsaeure-anhydrid |
| Phenol,4-arsenoso-2-nitro |
| 4-Arsenoso-2-nitrophenol |
| 3-Nitro-4-hydroxyphenylarsenous acid |
| Benzoic acid, 3-(aminosulfonyl)-5-nitro-4-phenoxy- |
| 3-Nitro-4-phenoxy-5-sulfamoyl-benzoesaeure |
| 3-nitro-4-phenoxy-5-sulfamylbenzoic acid |
| 3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid |
| 3-nitro-4-phenoxy-5-sulphamylbenzoic acid |
| 3-Nitro-4-oxy-phenylarsenoxyd |