Introduction：Basic information about CAS 6245-50-7|4,4'-(Butane-1,4-diylbis(oxy))dianiline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-(Butane-1,4-diylbis(oxy))dianiline |
|---|
| CAS Number | 6245-50-7 | Molecular Weight | 272.34200 |
|---|
| Density | 1.154 g/cm3 | Boiling Point | 502ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.4ºC |
|---|
Names
| Name | 4-[4-(4-aminophenoxy)butoxy]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.154 g/cm3 |
|---|
| Boiling Point | 502ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O2 |
|---|
| Molecular Weight | 272.34200 |
|---|
| Flash Point | 284.4ºC |
|---|
| Exact Mass | 272.15200 |
|---|
| PSA | 70.50000 |
|---|
| LogP | 4.25140 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | LAFZPVANKKJENB-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(OCCCCOc2ccc(N)cc2)cc1 |
|---|
Synonyms
| Diaminodiphenoxybutane |
| 4,4'-butanediyldioxy-di-aniline |
