Introduction:Basic information about CAS 14464-30-3|1-(Octanoyloxy)-2,5-pyrrolidinedione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(Octanoyloxy)-2,5-pyrrolidinedione |
|---|
| CAS Number | 14464-30-3 | Molecular Weight | 241.284 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 333.2±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H19NO4 | Melting Point | 61-63ºC |
|---|
| MSDS | / | Flash Point | 155.3±23.2 °C |
|---|
Names
| Name | 1-(Octanoyloxy)-2,5-pyrrolidinedione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 333.2±25.0 °C at 760 mmHg |
|---|
| Melting Point | 61-63ºC |
|---|
| Molecular Formula | C12H19NO4 |
|---|
| Molecular Weight | 241.284 |
|---|
| Flash Point | 155.3±23.2 °C |
|---|
| Exact Mass | 241.131409 |
|---|
| PSA | 63.68000 |
|---|
| LogP | 1.38 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | PEJVSXYBFAVPAQ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCC(=O)ON1C(=O)CCC1=O |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Safety Phrases | 22-24/25 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| octanoic acid succinimidyl ester |
| N-(octanoyloxy)succinimide |
| Octansaeure-sec-butylester |
| Octanoic acid,2-butyl ester |
| 2,5-dioxopyrrolidin-1-yl octanoate |
| sec-butyl caprylate |
| octanoic acid N-hydroxysuccinimide ester |
| Octanoic acid,1-methylpropyl ester |
| 2,5-Pyrrolidinedione, 1-[(1-oxooctyl)oxy]- |
| octanoic acid N-succinimidyl ester |
| octanoic acid sec-butyl ester |
| Caprylsaeure-2-butanester |
| 1-(Octanoyloxy)-2,5-pyrrolidinedione |
| Sec-butyl octanoate |