Introduction:Basic information about CAS 52584-39-1|Tolylbarb, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tolylbarb |
|---|
| CAS Number | 52584-39-1 | Molecular Weight | 246.262 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H14N2O3 | Melting Point | 177-178ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,3,7-trimethylpyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Melting Point | 177-178ºC(lit.) |
|---|
| Molecular Formula | C13H14N2O3 |
|---|
| Molecular Weight | 246.262 |
|---|
| Exact Mass | 246.100449 |
|---|
| PSA | 82.25000 |
|---|
| LogP | 2.13 |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | ZYJDWGKPBQDCBX-UHFFFAOYSA-N |
|---|
| SMILES | CCC1(c2ccc(C)cc2)C(=O)NC(=O)NC1=O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36 |
|---|
| Safety Phrases | 26 |
|---|
| HS Code | 2933540000 |
|---|
Customs
| HS Code | 2933540000 |
|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| Tolylbarb |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(4-methylphenyl)- |
| 1,3,7-trimethyl-1H,2H,3H,4H,7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| 5-Ethyl-5-(4-methylphenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 5-Ethyl-5-(4-methylphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| EINECS 258-023-9 |
| 1,3,7-trimethyl-1h-pyrrolo[2,3-d]pyrimidine-2,4(3h,7h)-dione |
| 1H-Pyrrolo(2,3-d)pyrimidine-2,4(3H,7H)-dione,1,3,7-trimethyl |