Introduction：Basic information about CAS 240482-96-6|(4-PHENOXYPHENYL)DIPHENYLSULFONIUM, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-PHENOXYPHENYL)DIPHENYLSULFONIUM |
|---|
| CAS Number | 240482-96-6 | Molecular Weight | 504.54100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C25H19F3O4S2 | Melting Point | 90-94ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | (4-phenoxyphenyl)-diphenylsulfanium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 90-94ºC(lit.) |
|---|
| Molecular Formula | C25H19F3O4S2 |
|---|
| Molecular Weight | 504.54100 |
|---|
| Exact Mass | 504.06800 |
|---|
| PSA | 100.11000 |
|---|
| LogP | 7.70650 |
|---|
| InChIKey | DFSWKIGXUOJVAC-UHFFFAOYSA-M |
|---|
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(Oc2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| MFCD02683566 |
| (4-PHENOXYPHENYL)DIPHENYLSULFONIUM |
| diphenyl-4-phenoxyphenylsulfonium trifluoromethanesulfonate |
| (4-PHENOXYPHENYL)DIPHENYLSULF |
| diphenyl(diphenyl ether)sulfonium triflate |
| diphenyl(4-phenoxy phenyl)sulfonium triflate |
