Introduction:Basic information about CAS 3205-18-3|4-AMINO-2,6-DINITROTOLUENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-AMINO-2,6-DINITROTOLUENE |
|---|
| CAS Number | 3205-18-3 | Molecular Weight | 316.26600 |
|---|
| Density | 1.381g/cm3 | Boiling Point | 461.213ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N2O6 | Melting Point | 122-125ºC(lit.) |
|---|
| MSDS | / | Flash Point | 196.635ºC |
|---|
Names
| Name | [(1S)-1-phenylethyl] 3,5-dinitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.381g/cm3 |
|---|
| Boiling Point | 461.213ºC at 760 mmHg |
|---|
| Melting Point | 122-125ºC(lit.) |
|---|
| Molecular Formula | C15H12N2O6 |
|---|
| Molecular Weight | 316.26600 |
|---|
| Flash Point | 196.635ºC |
|---|
| Exact Mass | 316.07000 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 4.46740 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | YATKDADIXNBBCZ-JTQLQIEISA-N |
|---|
| SMILES | CC(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-Dinitro-benzoesaeure-(1-phenyl-aethylester) |
| 3,5-dinitro-benzoic acid-(1-phenyl-ethyl ester) |
| (R,S)-sec-phenethyl-3,5-dinitrobenzoate |
| (+/-)-sec-Phenethyl alcohol 3,5-dinitrobenzoate |
| (S)-(+)-1-Phenylethyl 3,5-dinitrobenzoate |
| Benzoic acid,3,5-dinitro-,(1S)-1-phenylethyl ester |
| MFCD00674057 |