CAS 41636-35-5|2,3,7,8,12,13,17,18-Octaethyl-21H,23Hporphine ruthenium(II)carbonyl
Introduction:Basic information about CAS 41636-35-5|2,3,7,8,12,13,17,18-Octaethyl-21H,23Hporphine ruthenium(II)carbonyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,7,8,12,13,17,18-Octaethyl-21H,23Hporphine ruthenium(II)carbonyl | ||
|---|---|---|---|
| CAS Number | 41636-35-5 | Molecular Weight | 661.84100 |
| Density | / | Boiling Point | / |
| Molecular Formula | C37H44N4ORu | Melting Point | / |
| MSDS | ChineseUSA | Flash Point | / |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | carbon monoxide,2,3,7,8,12,13,17,18-octaethyl-1,4,5,10,11,14,15,20,21,23-decahydroporphyrin-22,24-diide,ruthenium(2+) |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Molecular Formula | C37H44N4ORu |
|---|---|
| Molecular Weight | 661.84100 |
| Exact Mass | 662.25600 |
| PSA | 50.50000 |
| LogP | 5.61280 |
| InChIKey | CRTFSNIGJRIMPF-UHFFFAOYSA-N |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4[n-]c(cc5nc(cc1n2)C(CC)=C5CC)c(CC)c4CC)c(CC)c3CC.[C-]#[O+].[Ru+2] |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
Articles4
More ArticlesAm. Chem. Soc. Symp. Ser. No. 152 , 243, (1981) | |
Inorganica Chim. Acta 85 , 209, (1984) | |
Aldrichimica Acta 19 , 81, (1986) |
Synonyms
| (2,3,7,8,12,13,17,18-octaethylporphyrinato)ruthenium(II) carbonyl |
| (2,3,7,8,12,13,17,18-octaethylporphyrinato)Ru(CO) |
| (octaethylporphyrinato)palladium(II) |
| MFCD00135460 |
| carbonylruthenium(II) octaethylporphyrin |
| chloride |
| palladium(II) 2,3,7,8,12,13,17,18-octaethylporphyrinate |
