Introduction：Basic information about CAS 22103-85-1|2-Benzoylbenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Benzoylbenzoyl chloride |
|---|
| CAS Number | 22103-85-1 | Molecular Weight | 244.67300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H9ClO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Benzoylbenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H9ClO2 |
|---|
| Molecular Weight | 244.67300 |
|---|
| Exact Mass | 244.02900 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.29660 |
|---|
| InChIKey | GJJVTLOHDLKVFS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccccc1C(=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| I14-1388 |
| 2-Benzoyl-benzoylchlorid |
| benzoyl-benzoyl chloride |
| o-benzoylbenzoyl chloride |
| Benzoylchloride,o-benzoyl-(6CI,8CI) |
| 2-benzoyl-benzoyl chloride |
| Benzoylbenzoic chloride |
| 2-Benzoyl-benzoesaeure-chlorid |
| Benzoyl chloride,2-benzoyl |
