Introduction：Basic information about CAS 32597-37-8|N-(3-Chlorophenyl)pivalamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(3-Chlorophenyl)pivalamide |
|---|
| CAS Number | 32597-37-8 | Molecular Weight | 211.68800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H14ClNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(3-Chlorophenyl)-2,2-dimethylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H14ClNO |
|---|
| Molecular Weight | 211.68800 |
|---|
| Exact Mass | 211.07600 |
|---|
| PSA | 32.59000 |
|---|
| LogP | 3.97410 |
|---|
| InChIKey | OGOQXGKPTWSHPS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(=O)Nc1cccc(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(3-chlorophenyl)pivalamide |
| 3-chloro-N-pivaloylaniline |
| 1H-Pyrazole-4-carboxamide,N-(3-chlorophenyl)-1,3,5-trimethyl |
| N-(3-chlorophenyl)-2,2-dimethylpropionamide |
| 3-chloro-1-(trimethylacetylamino)benzene |
| N-(3-chlorophenyl)-1,3,5-trimethyl-4-pyrazolecarboxamide |
| 1,3,5-trimethyl-1H-pyrazole-4-carboxylic acid 3-chloro-anilide |
| m-chloropivalanilid |
| 3-chloro-1-(pivaloyl)aminobenzene |
