Introduction：Basic information about CAS 100858-27-3|tert-Butyl-{3-[2-(diphenyl-phosphinoyl)-ethylidene]-4-methylene-cyclohexyloxy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl-{3-[2-(diphenyl-phosphinoyl)-ethylidene]-4-methylene-cyclohexyloxy}-dimethyl-silane |
|---|
| CAS Number | 100858-27-3 | Molecular Weight | 452.64100 |
|---|
| Density | 1.048 g/cm3 | Boiling Point | 507.183ºC at 760 mmHg |
|---|
| Molecular Formula | C27H37O2PSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 260.535ºC |
|---|
Names
| Name | tert-butyl-[3-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.048 g/cm3 |
|---|
| Boiling Point | 507.183ºC at 760 mmHg |
|---|
| Molecular Formula | C27H37O2PSi |
|---|
| Molecular Weight | 452.64100 |
|---|
| Flash Point | 260.535ºC |
|---|
| Exact Mass | 452.23000 |
|---|
| PSA | 36.11000 |
|---|
| LogP | 7.05740 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | OFSDSMTXHBTJEI-GUHCFGCBSA-N |
|---|
| SMILES | C=C1CCC(O[Si](C)(C)C(C)(C)C)CC1=CCP(=O)(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| TERT-BUTYL[3-[2-(DIPHENYLPHOSPHINOYL)ETHYLIDENE]-4-METHYLENECYCLOHEXYLOXY]DIMETHYLSILANE |
| [S-(Z)]-[2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethyl]diphenylphosphine oxide |
| tert-butyl-[(3E)-3-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane |
| Phosphine oxide,[(2Z)-2-[(5S)-5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethyl]diphenyl |
| (S)-(Z)-{2-[5-(tert-butyldimethylsiloxy)-2-methylenecyclohexylidene]ethyl}diphenylphosphine oxide |
| Phosphineoxide,[2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethyl]diphenyl-,[S-(Z)] |
| <<(1Z),(5S)>-2-<5-(t-butyldimethylsilyl)oxy-2-methylcyclohexylidene>>diphenylphosphine oxide |
