Introduction：Basic information about CAS 100884-80-8|1,3,5,7-Adamantanetetracarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5,7-Adamantanetetracarboxylic acid |
|---|
| CAS Number | 100884-80-8 | Molecular Weight | 312.27200 |
|---|
| Density | 1.9±0.1g/cm3 | Boiling Point | 403.6±40.0°C at 760 mmHg |
|---|
| Molecular Formula | C14H16O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.0±23.8°C |
|---|
Names
| Name | adamantane-1,3,5,7-tetracarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1g/cm3 |
|---|
| Boiling Point | 403.6±40.0°C at 760 mmHg |
|---|
| Molecular Formula | C14H16O8 |
|---|
| Molecular Weight | 312.27200 |
|---|
| Flash Point | 212.0±23.8°C |
|---|
| Exact Mass | 312.08500 |
|---|
| PSA | 149.20000 |
|---|
| LogP | 0.65180 |
|---|
| Index of Refraction | 1.722 |
|---|
| InChIKey | VWAIZPYLEYEEFK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C12CC3(C(=O)O)CC(C(=O)O)(C1)CC(C(=O)O)(C2)C3 |
|---|
Synonyms
| 1,3,5,7-Adamantanetetracarboxylicacid (6CI) |
| adamantanetetracarboxylic acid |
| Tricyclo[3.3.1.13,7]decane-1,3,5,7-tetracarboxylicacid |
| 1,3,5,7-Adamantanetetracarboxylic acid |
