Introduction：Basic information about CAS 107-50-6|Tetradecamethyl Cycloheptasiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetradecamethyl Cycloheptasiloxane |
|---|
| CAS Number | 107-50-6 | Molecular Weight | 519.07800 |
|---|
| Density | 0.97g/cm3 | Boiling Point | 336.5ºC at 760mmHg |
|---|
| Molecular Formula | C14H42O7Si7 | Melting Point | -32 °C |
|---|
| MSDS | / | Flash Point | 150.7ºC |
|---|
Names
| Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14-tetradecamethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.97g/cm3 |
|---|
| Boiling Point | 336.5ºC at 760mmHg |
|---|
| Melting Point | -32 °C |
|---|
| Molecular Formula | C14H42O7Si7 |
|---|
| Molecular Weight | 519.07800 |
|---|
| Flash Point | 150.7ºC |
|---|
| Exact Mass | 518.13200 |
|---|
| PSA | 64.61000 |
|---|
| LogP | 5.02880 |
|---|
| Vapour Pressure | 0.000217mmHg at 25°C |
|---|
| Index of Refraction | 1.432 |
|---|
| InChIKey | GSANOGQCVHBHIF-UHFFFAOYSA-N |
|---|
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
|---|
Synonyms
| Cycloheptasiloxane,tetradecamethyl |
| tetradecamethyl-cycloheptasiloxane |
| Tetradecamethyl-cycloheptasiloxan |
| EINECS 203-496-9 |
| 2,2,4,4,6,6,8,8,10,10,12,12,14,14-Tetradecamethylcycloheptasiloxane |
| tetradecamethylheptasiloxane |
| Tetradecamethyl Cycloheptasiloxane |
