Introduction：Basic information about CAS 107021-84-1|1-(4-chlorobenzyl)-(1H-1,2,4-triazol-yl)-pinacolone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-chlorobenzyl)-(1H-1,2,4-triazol-yl)-pinacolone |
|---|
| CAS Number | 107021-84-1 | Molecular Weight | 291.77600 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 432.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H18ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.6ºC |
|---|
Names
| Name | 2-[(4-chlorophenyl)methyl]-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-1-one |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 432.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H18ClN3O |
|---|
| Molecular Weight | 291.77600 |
|---|
| Flash Point | 215.6ºC |
|---|
| Exact Mass | 291.11400 |
|---|
| PSA | 47.78000 |
|---|
| LogP | 3.47670 |
|---|
| Vapour Pressure | 1.08E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | GUDHIBLACZULSY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(Cc1ccc(Cl)cc1)C(=O)n1cncn1 |
|---|
