Introduction:Basic information about CAS 74214-63-4|9H-pyrido[3,4-b]indole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|
| CAS Number | 74214-63-4 | Molecular Weight | 212.20400 |
|---|
| Density | 1.497g/cm3 | Boiling Point | 538.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 279.6ºC |
|---|
Names
| Name | 9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.497g/cm3 |
|---|
| Boiling Point | 538.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8N2O2 |
|---|
| Molecular Weight | 212.20400 |
|---|
| Flash Point | 279.6ºC |
|---|
| Exact Mass | 212.05900 |
|---|
| PSA | 65.98000 |
|---|
| LogP | 2.41430 |
|---|
| Index of Refraction | 1.814 |
|---|
| InChIKey | ARLVFKCLBYUINL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2c(cn1)[nH]c1ccccc12 |
|---|
Synonyms
| 9H-pyrido<3,4-b>indole-3-carboxylic acid |
| Carboline-3-carboxylic acid |