Introduction:Basic information about CAS 2491-32-9|Ethanone,1-(4-hydroxyphenyl)-2-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone,1-(4-hydroxyphenyl)-2-phenyl- |
|---|
| CAS Number | 2491-32-9 | Molecular Weight | 212.24400 |
|---|
| Density | 1.178g/cm3 | Boiling Point | 403.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12O2 | Melting Point | 148-151ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 172.2ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-(4-hydroxyphenyl)-2-phenylethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.178g/cm3 |
|---|
| Boiling Point | 403.3ºC at 760 mmHg |
|---|
| Melting Point | 148-151ºC(lit.) |
|---|
| Molecular Formula | C14H12O2 |
|---|
| Molecular Weight | 212.24400 |
|---|
| Flash Point | 172.2ºC |
|---|
| Exact Mass | 212.08400 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.81760 |
|---|
| Vapour Pressure | 4.42E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | JBQTZLNCDIFCCO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cc1ccccc1)c1ccc(O)cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37-S39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2914501900 |
|---|
Customs
| HS Code | 2914501900 |
|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4'-Hydroxydeoxybenzoin |
| MFCD00002360 |
| 4-hydroxyphenyl benzyl ketone |
| Benzyl 4-hydroxyphenyl ketone |
| p-phenylacetylphenol |
| EINECS 219-654-5 |
| 4'-hydroxy-2-phenylacetophenone |
| Acetophenone,4'-hydroxy-2-phenyl |