Introduction：Basic information about CAS 41295-55-0|4-(chloromethyl)-7-methoxychromen-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(chloromethyl)-7-methoxychromen-2-one |
|---|
| CAS Number | 41295-55-0 | Molecular Weight | 224.64000 |
|---|
| Density | 1.309g/cm3 | Boiling Point | 373ºC at 760mmHg |
|---|
| Molecular Formula | C11H9ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.2ºC |
|---|
Names
| Name | 4-(chloromethyl)-7-methoxychromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.309g/cm3 |
|---|
| Boiling Point | 373ºC at 760mmHg |
|---|
| Molecular Formula | C11H9ClO3 |
|---|
| Molecular Weight | 224.64000 |
|---|
| Flash Point | 165.2ºC |
|---|
| Exact Mass | 224.02400 |
|---|
| PSA | 39.44000 |
|---|
| LogP | 2.54040 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | ISPBECDEFRIYTA-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(CCl)cc(=O)oc2c1 |
|---|
Safety Information
Customs
| HS Code | 2932209090 |
|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-chloromethyl-7-methoxy-2-oxo-benzopyran |
| 4-(chloromethyl)-7-methoxy-2H-chromen-2-one |
| 40(chloromethyl)-7-methoxycounarin |
| 4-Chloromethyl-7-methoxy-chromen-2-one |
| 7-methoxy-4-(chloromethyl)coumarine |
| 4-chloromethyl-7-methoxycoumarin |
| MFCD03731259 |
| 4-chloromethyl-7-methoxy-2-oxo-2H-benzopyran |
| 6-methoxy-1-chloromethyl-3-oxo-3H-benzopyran |
