Introduction：Basic information about CAS 56558-16-8|2,2',4,6,6'-PCB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',4,6,6'-PCB |
|---|
| CAS Number | 56558-16-8 | Molecular Weight | 326.433 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 341.6±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H5Cl5 | Melting Point | 85°C |
|---|
| MSDS | / | Flash Point | 156.1±23.9 °C |
|---|
Names
| Name | 2,2',4,6,6'-Pentachlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 341.6±37.0 °C at 760 mmHg |
|---|
| Melting Point | 85°C |
|---|
| Molecular Formula | C12H5Cl5 |
|---|
| Molecular Weight | 326.433 |
|---|
| Flash Point | 156.1±23.9 °C |
|---|
| Exact Mass | 323.883392 |
|---|
| LogP | 6.51 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | MTCPZNVSDFCBBE-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cc(Cl)c(-c2c(Cl)cccc2Cl)c(Cl)c1 |
|---|
Synonyms
| 1,1'-Biphenyl, 2,2',4,6,6'-pentachloro- |
| 2,2',4,6,6'-Pentachlorobiphenyl |
| 1,3,5-trichloro-2-(2,6-dichlorophenyl)benzene |
| 2,2',4,6,6'-Pentachloro-1,1'-biphenyl |
| 2,2',4,6,6'-PCB |
