Introduction：Basic information about CAS 221615-72-1|1-(6-Methylpyridin-3-yl)-2-(4-(Methylthio)phenyl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(6-Methylpyridin-3-yl)-2-(4-(Methylthio)phenyl)ethanone |
|---|
| CAS Number | 221615-72-1 | Molecular Weight | 257.351 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 426.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H15NOS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.8±27.3 °C |
|---|
Names
| Name | 1-(6-Methyl-3-pyridinyl)-2-[4-(methylsulfanyl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 426.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H15NOS |
|---|
| Molecular Weight | 257.351 |
|---|
| Flash Point | 211.8±27.3 °C |
|---|
| Exact Mass | 257.087433 |
|---|
| PSA | 55.26000 |
|---|
| LogP | 2.93 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | QCTITLPDUACHDS-UHFFFAOYSA-N |
|---|
| SMILES | CSc1ccc(CC(=O)c2ccc(C)nc2)cc1 |
|---|
Synonyms
| 1-(6-Methylpyridin-3-yl)-2-[4-(methylthio)phenyl]ethanone |
| 1-(6-Methyl-3-pyridinyl)-2-[4-(methylsulfanyl)phenyl]ethanone |
| Ethanone, 1-(6-methyl-3-pyridinyl)-2-[4-(methylthio)phenyl]- |
| 1-(6-Methylpyridin-3-yl)-2-(4-(Methylthio)phenyl)ethanone |
| Etoricoxib Intermediate 1 |
