Introduction:Basic information about CAS 4171-83-9|2-Nitrodiphenylsulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitrodiphenylsulfide |
|---|
| CAS Number | 4171-83-9 | Molecular Weight | 231.270 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 343.3±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9NO2S | Melting Point | 78-82 °C(lit.) |
|---|
| MSDS | / | Flash Point | 161.4±23.2 °C |
|---|
Names
| Name | 2-Nitrophenyl phenyl sulfide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 343.3±25.0 °C at 760 mmHg |
|---|
| Melting Point | 78-82 °C(lit.) |
|---|
| Molecular Formula | C12H9NO2S |
|---|
| Molecular Weight | 231.270 |
|---|
| Flash Point | 161.4±23.2 °C |
|---|
| Exact Mass | 231.035400 |
|---|
| PSA | 71.12000 |
|---|
| LogP | 4.38 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | ZPWNCSAEXUDWTN-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1Sc1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Nitrophenyl Phenyl Sulfide |
| 2-Nitrodiphenylsulfide |
| 1-nitro-2-phenylsulfanylbenzene |
| Sulfide, o-nitrophenyl phenyl |
| 2-Nitrodiphenyl Sulfide |
| 1-Nitro-2-(phenylsulfanyl)benzene |
| Benzene, 1-nitro-2-(phenylthio)- |
| Benzene, 1-nitro-2- (phenylthio)- |
| 1-Nitro-2-(phenylthio)benzene |
| MFCD00100508 |