Introduction:Basic information about CAS 2712-78-9|[Bis(trifluoroacetoxy)iodo]benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [Bis(trifluoroacetoxy)iodo]benzene |
|---|
| CAS Number | 2712-78-9 | Molecular Weight | 430.039 |
|---|
| Density | 1.95g/cm3 | Boiling Point | 267.573ºC at 760 mmHg |
|---|
| Molecular Formula | C10H5F6IO4 | Melting Point | 121-125 °C(lit.) |
|---|
| MSDS | / | Flash Point | 115.624ºC |
|---|
Names
| Name | [phenyl-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl] 2,2,2-trifluoroacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.95g/cm3 |
|---|
| Boiling Point | 267.573ºC at 760 mmHg |
|---|
| Melting Point | 121-125 °C(lit.) |
|---|
| Molecular Formula | C10H5F6IO4 |
|---|
| Molecular Weight | 430.039 |
|---|
| Flash Point | 115.624ºC |
|---|
| Exact Mass | 429.913666 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.40360 |
|---|
| Vapour Pressure | 0.008mmHg at 25°C |
|---|
| Index of Refraction | 1.483 |
|---|
| InChIKey | PEZNEXFPRSOYPL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OI(OC(=O)C(F)(F)F)c1ccccc1)C(F)(F)F |
|---|
| Storage condition | Keep Cold |
|---|
| Water Solubility | insoluble |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29036990 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| phenyliodine bis(trifluoroacetate) |
| Iodine, phenylbis[(2,2,2-trifluoroacetyl)oxy]- |
| EINECS 220-308-0 |
| Phenyl[bis(2,2,2-trifluoroacetoxy)]-λ-iodane |
| [Bis(trifluoroacetoxy)iodo]benzene |
| phenyliodine(iii) bis(trifluoroacetate) |
| Iodobenzene I,I-bis(trifluoroacetate) |
| PIFA |
| Iodosobenzene bis(trifluoroacetate) |
| Phenylbis(trifluoroacetato-O)iodine |
| MFCD00009672 |
| (Bis(trifluoroacetoxy)iodo)benzene |
| Bis(trifluoroacetoxy)iodobenzene |
| phenyl{bis[(trifluoroacetyl)oxy]}-λ-iodane |