Introduction：Basic information about CAS 56960-81-7|2-AMINO-3-CHLORO-5-NITRO-6-PICOLINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-AMINO-3-CHLORO-5-NITRO-6-PICOLINE |
|---|
| CAS Number | 56960-81-7 | Molecular Weight | 187.58400 |
|---|
| Density | 1.501g/cm3 | Boiling Point | 313.197ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.217ºC |
|---|
Names
| Name | 3-chloro-6-methyl-5-nitropyridin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.501g/cm3 |
|---|
| Boiling Point | 313.197ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6ClN3O2 |
|---|
| Molecular Weight | 187.58400 |
|---|
| Flash Point | 143.217ºC |
|---|
| Exact Mass | 187.01500 |
|---|
| PSA | 84.73000 |
|---|
| LogP | 2.63820 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | JUXCWOVRMIHTRK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(N)c(Cl)cc1[N+](=O)[O-] |
|---|
Synonyms
| 3-chloro-6-methyl-5-nitro-[2]pyridylamine |
| 2-Amino-3-chlor-6-methyl-5-nitro-pyridin |
| 3-chloro-6-methyl-5-nitro-2-pyridinamine |
| 3-chloranyl-6-methyl-5-nitro-pyridin-2-amine |
| 3-Chlor-6-methyl-5-nitro-[2]pyridylamin |
| 2-Amino-3-chloro-5-nitro-6-picoline |
