Introduction：Basic information about CAS 116519-00-7|4-[(E)-2-(3,4,5-Trimethoxyphenyl)vinyl]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(E)-2-(3,4,5-Trimethoxyphenyl)vinyl]phenol |
|---|
| CAS Number | 116519-00-7 | Molecular Weight | 286.322 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 440.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.0±27.3 °C |
|---|
Names
| Name | 4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 440.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H18O4 |
|---|
| Molecular Weight | 286.322 |
|---|
| Flash Point | 220.0±27.3 °C |
|---|
| Exact Mass | 286.120514 |
|---|
| PSA | 47.92000 |
|---|
| LogP | 3.89 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | PGNACKMMQGBVTN-SNAWJCMRSA-N |
|---|
| SMILES | COc1cc(C=Cc2ccc(O)cc2)cc(OC)c1OC |
|---|
Synonyms
| Phenol, 4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]- |
| (E)-4'-hydroxy-3,4,5-trimethoxystilbene |
| 3,4,5-trimethoxy-4'-hydroxystilbene |
| (E)-4-[2-(3,4,5-TRIMETHOXYPHENYL)ETHENYL]PHENOL |
| 3',4',5'-trimethoxy-trans-stilben-4-ol |
| (E)-1-(4-Hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethene |
| 4-[(E)-2-(3,4,5-Trimethoxyphenyl)vinyl]phenol |
| (E)-4-(3,4,5-trimethoxystyryl)phenol |
| Phenol,4-[(1E)-2-(3,4,5-trimethoxyphenyl)ethenyl] |
