CAS 61240-22-0|1,2-Bis(3,4,5-trimethoxyphenyl)ethylene
Introduction：Basic information about CAS 61240-22-0|1,2-Bis(3,4,5-trimethoxyphenyl)ethylene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Bis(3,4,5-trimethoxyphenyl)ethylene | ||
|---|---|---|---|
| CAS Number | 61240-22-0 | Molecular Weight | 360.401 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 493.0±40.0 °C at 760 mmHg |
| Molecular Formula | C20H24O6 | Melting Point | / |
| MSDS | / | Flash Point | 200.0±27.2 °C |
Names
| Name | (E)-3,4,5,3',4',5'-Hexamethoxystilbene |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.0±40.0 °C at 760 mmHg |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.401 |
| Flash Point | 200.0±27.2 °C |
| Exact Mass | 360.157288 |
| PSA | 55.38000 |
| LogP | 4.01 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | DUESHOUIPOUGCU-BQYQJAHWSA-N |
| SMILES | COc1cc(C=Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
Synonyms
| (E)-1,2-bis(3,4,5-trimethoxyphenyl)ethene |
| 1,2-bis(3,4,5-trimethoxyphenyl) ethylene |
| 3,4,5,3',4',5'-Hexamethoxy-trans-stilben |
| trans-3,3',4,4',5,5'-hexamethoxystilbene |
| 1,2,3-Trimethoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene |
| 3,4,5,3',4',5'-hexamethoxy-trans-stilbene |
| 2,2'-dimethylstilbene |
| (E)-2,2'-dimethylstilbene |
| (E)-1,2-bis(2-methylphenyl)ethene |
| Benzene, 1,1'-[(E)-1,2-ethenediyl]bis[3,4,5-trimethoxy- |
| 1,1'-(E)-ethene-1,2-diylbis(3,4,5-trimethoxybenzene) |
| (E)-3,3',4,4',5,5'-hexamethoxystilbene |
| trans-2,2'-dimethylstilbene |
| 1-methyl-2-[(Z)-2-(o-tolyl)-vinyl]-benzene |
| 2,2'-dimethyl-E-stilbene |
| 1,1'-[(E)-1,2-Ethenediyl]bis(3,4,5-trimethoxybenzene) |
| 1,2-Bis(3,4,5-trimethoxyphenyl)ethylene |
| dehydrobrittonin A |
| (E)-1,2-di(2-methylphenyl)ethene |
